C30H30Br2N2O2S5 — CID 102585362
4,7-bis(5-bromothieno[3,2-b]thiophen-2-yl)-5,6-dihexoxy-2,1,3-benzothiadiazole (PubChem CID 102585362) has the molecular formula C30H30Br2N2O2S5 and a molecular weight of 770.72 g/mol. Its IUPAC name is 4,7-bis(5-bromothieno[3,2-b]thiophen-2-yl)-5,6-dihexoxy-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis(5-bromothieno[3,2-b]thiophen-2-yl)-5,6-dihexoxy-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 102585362 |
| Molecular Formula | C30H30Br2N2O2S5 |
| Molecular Weight | 770.72 g/mol |
| Exact Mass | 767.93 |
| IUPAC Name | 4,7-bis(5-bromothieno[3,2-b]thiophen-2-yl)-5,6-dihexoxy-2,1,3-benzothiadiazole |
| SMILES | CCCCCCOc1c(OCCCCCC)c(-c2cc3sc(Br)cc3s2)c2nsnc2c1-c1cc2sc(Br)cc2s1 |
| InChI | InChI=1S/C30H30Br2N2O2S5/c1-3-5-7-9-11-35-29-25(21-13-17-19(37-21)15-23(31)39-17)27-28(34-41-33-27)26(30(29)36-12-10-8-6-4-2)22-14-18-20(38-22)16-24(32)40-18/h13-16H,3-12H2,1-2H3 |
| InChIKey | NVZRXJXIRUQZQF-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.72 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|