C13H16BrNOS — CID 71149222
2-bromo-5-hexoxythieno[2,3-c]pyridine (PubChem CID 71149222) has the molecular formula C13H16BrNOS and a molecular weight of 314.25 g/mol. Its IUPAC name is 2-bromo-5-hexoxythieno[2,3-c]pyridine.
| Compound Name | 2-bromo-5-hexoxythieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 71149222 |
| Molecular Formula | C13H16BrNOS |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 2-bromo-5-hexoxythieno[2,3-c]pyridine |
| SMILES | CCCCCCOc1cc2cc(Br)sc2cn1 |
| InChI | InChI=1S/C13H16BrNOS/c1-2-3-4-5-6-16-13-8-10-7-12(14)17-11(10)9-15-13/h7-9H,2-6H2,1H3 |
| InChIKey | LVXICYJFXKEYIT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|