About 3-dodecoxythieno[3,4-b]pyrazine
3-dodecoxythieno[3,4-b]pyrazine (PubChem CID 139758024) has the molecular formula C18H28N2OS
and a molecular weight of 320.50 g/mol. Its IUPAC name is 3-dodecoxythieno[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 3-dodecoxythieno[3,4-b]pyrazine |
| PubChem CID | 139758024 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 3-dodecoxythieno[3,4-b]pyrazine |
| SMILES | CCCCCCCCCCCCOc1cnc2cscc2n1 |
| InChI | InChI=1S/C18H28N2OS/c1-2-3-4-5-6-7-8-9-10-11-12-21-18-13-19-16-14-22-15-17(16)20-18/h13-15H,2-12H2,1H3 |
| InChIKey | NANROHYRDUKWOS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-dodecoxythieno[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dodecoxythieno[3,4-b]pyrazine?
The IUPAC name of 3-dodecoxythieno[3,4-b]pyrazine (CID 139758024) is 3-dodecoxythieno[3,4-b]pyrazine.
What is the SMILES notation for 3-dodecoxythieno[3,4-b]pyrazine?
The canonical SMILES for 3-dodecoxythieno[3,4-b]pyrazine is CCCCCCCCCCCCOc1cnc2cscc2n1.
What is the InChIKey of 3-dodecoxythieno[3,4-b]pyrazine?
The InChIKey is NANROHYRDUKWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2OS/c1-2-3-4-5-6-7-8-9-10-11-12-21-18-13-19-16-14-22-15-17(16)20-18/h13-15H,2-12H2,1H3.
What are the key properties of 3-dodecoxythieno[3,4-b]pyrazine?
3-dodecoxythieno[3,4-b]pyrazine has a molecular weight of 320.50 g/mol, XLogP of 5.99, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dodecoxythieno[3,4-b]pyrazine is sourced from PubChem (CID 139758024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).