C18H32O2S — CID 175595567
3,4-dihexoxythiophene;ethene (PubChem CID 175595567) has the molecular formula C18H32O2S and a molecular weight of 312.52 g/mol. Its IUPAC name is 3,4-dihexoxythiophene;ethene.
| Compound Name | 3,4-dihexoxythiophene;ethene |
|---|---|
| PubChem CID | 175595567 |
| Molecular Formula | C18H32O2S |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 3,4-dihexoxythiophene;ethene |
| SMILES | C=C.CCCCCCOc1cscc1OCCCCCC |
| InChI | InChI=1S/C16H28O2S.C2H4/c1-3-5-7-9-11-17-15-13-19-14-16(15)18-12-10-8-6-4-2;1-2/h13-14H,3-12H2,1-2H3;1-2H2 |
| InChIKey | BRGHVGJXUZUUGO-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|