C35H43BrN2OS4 — CID 118028927
7-(5-bromothiophen-2-yl)-6-methyl-5-octoxy-4-[5-(5-octylthiophen-2-yl)thiophen-2-yl]-2,1,3-benzothiadiazole (PubChem CID 118028927) has the molecular formula C35H43BrN2OS4 and a molecular weight of 715.91 g/mol. Its IUPAC name is 7-(5-bromothiophen-2-yl)-6-methyl-5-octoxy-4-[5-(5-octylthiophen-2-yl)thiophen-2-yl]-2,1,3-benzothiadiazole.
| Compound Name | 7-(5-bromothiophen-2-yl)-6-methyl-5-octoxy-4-[5-(5-octylthiophen-2-yl)thiophen-2-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 118028927 |
| Molecular Formula | C35H43BrN2OS4 |
| Molecular Weight | 715.91 g/mol |
| Exact Mass | 714.14 |
| IUPAC Name | 7-(5-bromothiophen-2-yl)-6-methyl-5-octoxy-4-[5-(5-octylthiophen-2-yl)thiophen-2-yl]-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCOc1c(C)c(-c2ccc(Br)s2)c2nsnc2c1-c1ccc(-c2ccc(CCCCCCCC)s2)s1 |
| InChI | InChI=1S/C35H43BrN2OS4/c1-4-6-8-10-12-14-16-25-17-18-26(40-25)27-19-20-29(41-27)32-34-33(37-43-38-34)31(28-21-22-30(36)42-28)24(3)35(32)39-23-15-13-11-9-7-5-2/h17-22H,4-16,23H2,1-3H3 |
| InChIKey | MYERKURWNGJGCK-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.91 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|