C23H20BrN3S4 — CID 67817048
7-bromo-4-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine (PubChem CID 67817048) has the molecular formula C23H20BrN3S4 and a molecular weight of 546.61 g/mol. Its IUPAC name is 7-bromo-4-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine.
| Compound Name | 7-bromo-4-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 67817048 |
| Molecular Formula | C23H20BrN3S4 |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 544.97 |
| IUPAC Name | 7-bromo-4-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(-c4ncc(Br)c5nsnc45)s3)s2)s1 |
| InChI | InChI=1S/C23H20BrN3S4/c1-2-3-4-5-6-14-7-8-16(28-14)17-9-10-18(29-17)19-11-12-20(30-19)22-23-21(26-31-27-23)15(24)13-25-22/h7-13H,2-6H2,1H3 |
| InChIKey | DDSXQZHWZKBKDQ-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|