C44H48Br2N2S2 — CID 141341816
5,8-dibromo-2,3-bis[4-(5-octylthiophen-2-yl)phenyl]quinoxaline (PubChem CID 141341816) has the molecular formula C44H48Br2N2S2 and a molecular weight of 828.82 g/mol. Its IUPAC name is 5,8-dibromo-2,3-bis[4-(5-octylthiophen-2-yl)phenyl]quinoxaline.
| Compound Name | 5,8-dibromo-2,3-bis[4-(5-octylthiophen-2-yl)phenyl]quinoxaline |
|---|---|
| PubChem CID | 141341816 |
| Molecular Formula | C44H48Br2N2S2 |
| Molecular Weight | 828.82 g/mol |
| Exact Mass | 826.16 |
| IUPAC Name | 5,8-dibromo-2,3-bis[4-(5-octylthiophen-2-yl)phenyl]quinoxaline |
| SMILES | CCCCCCCCc1ccc(-c2ccc(-c3nc4c(Br)ccc(Br)c4nc3-c3ccc(-c4ccc(CCCCCCCC)s4)cc3)cc2)s1 |
| InChI | InChI=1S/C44H48Br2N2S2/c1-3-5-7-9-11-13-15-35-25-29-39(49-35)31-17-21-33(22-18-31)41-42(48-44-38(46)28-27-37(45)43(44)47-41)34-23-19-32(20-24-34)40-30-26-36(50-40)16-14-12-10-8-6-4-2/h17-30H,3-16H2,1-2H3 |
| InChIKey | IGYOJMCLQYCWES-UHFFFAOYSA-N |
| XLogP | 15.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.82 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|