C22H23Br2N3S3 — CID 132938996
4,7-bis(5-bromothiophen-2-yl)-N-octyl-2,1,3-benzothiadiazol-5-amine (PubChem CID 132938996) has the molecular formula C22H23Br2N3S3 and a molecular weight of 585.46 g/mol. Its IUPAC name is 4,7-bis(5-bromothiophen-2-yl)-N-octyl-2,1,3-benzothiadiazol-5-amine.
| Compound Name | 4,7-bis(5-bromothiophen-2-yl)-N-octyl-2,1,3-benzothiadiazol-5-amine |
|---|---|
| PubChem CID | 132938996 |
| Molecular Formula | C22H23Br2N3S3 |
| Molecular Weight | 585.46 g/mol |
| Exact Mass | 582.94 |
| IUPAC Name | 4,7-bis(5-bromothiophen-2-yl)-N-octyl-2,1,3-benzothiadiazol-5-amine |
| SMILES | CCCCCCCCNc1cc(-c2ccc(Br)s2)c2nsnc2c1-c1ccc(Br)s1 |
| InChI | InChI=1S/C22H23Br2N3S3/c1-2-3-4-5-6-7-12-25-15-13-14(16-8-10-18(23)28-16)21-22(27-30-26-21)20(15)17-9-11-19(24)29-17/h8-11,13,25H,2-7,12H2,1H3 |
| InChIKey | BGOOOIWUXSHSHJ-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.46 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|