C15H17BrO4 — CID 15362253
2-bromo-1,4,5,8-tetramethoxy-3-methylnaphthalene (PubChem CID 15362253) has the molecular formula C15H17BrO4 and a molecular weight of 341.20 g/mol. Its IUPAC name is 2-bromo-1,4,5,8-tetramethoxy-3-methylnaphthalene.
| Compound Name | 2-bromo-1,4,5,8-tetramethoxy-3-methylnaphthalene |
|---|---|
| PubChem CID | 15362253 |
| Molecular Formula | C15H17BrO4 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-bromo-1,4,5,8-tetramethoxy-3-methylnaphthalene |
| SMILES | COc1ccc(OC)c2c(OC)c(Br)c(C)c(OC)c12 |
| InChI | InChI=1S/C15H17BrO4/c1-8-13(16)15(20-5)12-10(18-3)7-6-9(17-2)11(12)14(8)19-4/h6-7H,1-5H3 |
| InChIKey | NJBFDBNEFMOVQS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |