C18H10Br4O2 — CID 170567167
1,3,6,8-tetrabromo-2,7-dimethoxypyrene (PubChem CID 170567167) has the molecular formula C18H10Br4O2 and a molecular weight of 577.89 g/mol. Its IUPAC name is 1,3,6,8-tetrabromo-2,7-dimethoxypyrene.
| Compound Name | 1,3,6,8-tetrabromo-2,7-dimethoxypyrene |
|---|---|
| PubChem CID | 170567167 |
| Molecular Formula | C18H10Br4O2 |
| Molecular Weight | 577.89 g/mol |
| Exact Mass | 573.74 |
| IUPAC Name | 1,3,6,8-tetrabromo-2,7-dimethoxypyrene |
| SMILES | COc1c(Br)c2ccc3c(Br)c(OC)c(Br)c4ccc(c1Br)c2c34 |
| InChI | InChI=1S/C18H10Br4O2/c1-23-17-13(19)7-3-5-9-12-10(16(22)18(24-2)15(9)21)6-4-8(11(7)12)14(17)20/h3-6H,1-2H3 |
| InChIKey | HUSYZJVYKWHWIQ-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.89 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|