C26H28Br2O2 — CID 102599089
4,5-dibromo-2,7-ditert-butyl-9,10-dimethoxypyrene (PubChem CID 102599089) has the molecular formula C26H28Br2O2 and a molecular weight of 532.32 g/mol. Its IUPAC name is 4,5-dibromo-2,7-ditert-butyl-9,10-dimethoxypyrene.
| Compound Name | 4,5-dibromo-2,7-ditert-butyl-9,10-dimethoxypyrene |
|---|---|
| PubChem CID | 102599089 |
| Molecular Formula | C26H28Br2O2 |
| Molecular Weight | 532.32 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | 4,5-dibromo-2,7-ditert-butyl-9,10-dimethoxypyrene |
| SMILES | COc1c(OC)c2cc(C(C)(C)C)cc3c(Br)c(Br)c4cc(C(C)(C)C)cc1c4c32 |
| InChI | InChI=1S/C26H28Br2O2/c1-25(2,3)13-9-15-19-17(11-13)23(29-7)24(30-8)18-12-14(26(4,5)6)10-16(20(18)19)22(28)21(15)27/h9-12H,1-8H3 |
| InChIKey | OKSBKAWHTNDZBM-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.32 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|