C7H6BrN3S — CID 19691938
4-bromo-7-methyl-2,1,3-benzothiadiazol-5-amine (PubChem CID 19691938) has the molecular formula C7H6BrN3S and a molecular weight of 244.12 g/mol. Its IUPAC name is 4-bromo-7-methyl-2,1,3-benzothiadiazol-5-amine.
| Compound Name | 4-bromo-7-methyl-2,1,3-benzothiadiazol-5-amine |
|---|---|
| PubChem CID | 19691938 |
| Molecular Formula | C7H6BrN3S |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | 4-bromo-7-methyl-2,1,3-benzothiadiazol-5-amine |
| SMILES | Cc1cc(N)c(Br)c2nsnc12 |
| InChI | InChI=1S/C7H6BrN3S/c1-3-2-4(9)5(8)7-6(3)10-12-11-7/h2H,9H2,1H3 |
| InChIKey | YUDDBBJPUMBOSU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|