C13H10Cl2N4S — CID 65474446
4-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-methylbenzene-1,4-diamine (PubChem CID 65474446) has the molecular formula C13H10Cl2N4S and a molecular weight of 325.22 g/mol. Its IUPAC name is 4-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-methylbenzene-1,4-diamine.
| Compound Name | 4-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 65474446 |
| Molecular Formula | C13H10Cl2N4S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 4-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(Nc2c(Cl)cc(Cl)c3nsnc23)ccc1N |
| InChI | InChI=1S/C13H10Cl2N4S/c1-6-4-7(2-3-10(6)16)17-11-8(14)5-9(15)12-13(11)19-20-18-12/h2-5,17H,16H2,1H3 |
| InChIKey | ZEGWSDMGBGIRIW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|