C8H7F4NO2 — CID 87932656
2,3,5,6-tetrafluoro-N,4-dimethoxyaniline (PubChem CID 87932656) has the molecular formula C8H7F4NO2 and a molecular weight of 225.14 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N,4-dimethoxyaniline.
| Compound Name | 2,3,5,6-tetrafluoro-N,4-dimethoxyaniline |
|---|---|
| PubChem CID | 87932656 |
| Molecular Formula | C8H7F4NO2 |
| Molecular Weight | 225.14 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N,4-dimethoxyaniline |
| SMILES | CONc1c(F)c(F)c(OC)c(F)c1F |
| InChI | InChI=1S/C8H7F4NO2/c1-14-8-5(11)3(9)7(13-15-2)4(10)6(8)12/h13H,1-2H3 |
| InChIKey | DMHKEHKEPJVUBL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.14 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|