C8H8F3OP — CID 130350721
(2,4,5-trifluoro-3-methoxy-6-methylphenyl)phosphane (PubChem CID 130350721) has the molecular formula C8H8F3OP and a molecular weight of 208.12 g/mol. Its IUPAC name is (2,4,5-trifluoro-3-methoxy-6-methylphenyl)phosphane.
| Compound Name | (2,4,5-trifluoro-3-methoxy-6-methylphenyl)phosphane |
|---|---|
| PubChem CID | 130350721 |
| Molecular Formula | C8H8F3OP |
| Molecular Weight | 208.12 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | (2,4,5-trifluoro-3-methoxy-6-methylphenyl)phosphane |
| SMILES | COc1c(F)c(F)c(C)c(P)c1F |
| InChI | InChI=1S/C8H8F3OP/c1-3-4(9)5(10)7(12-2)6(11)8(3)13/h13H2,1-2H3 |
| InChIKey | YBZDGGQFGSTJHO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.12 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|