C9H8F3NO2S — CID 174559775
N-[1-(2,3,5-trifluoro-4-methoxy-6-sulfanylphenyl)ethylidene]hydroxylamine (PubChem CID 174559775) has the molecular formula C9H8F3NO2S and a molecular weight of 251.23 g/mol. Its IUPAC name is N-[1-(2,3,5-trifluoro-4-methoxy-6-sulfanylphenyl)ethylidene]hydroxylamine.
| Compound Name | N-[1-(2,3,5-trifluoro-4-methoxy-6-sulfanylphenyl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 174559775 |
| Molecular Formula | C9H8F3NO2S |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | N-[1-(2,3,5-trifluoro-4-methoxy-6-sulfanylphenyl)ethylidene]hydroxylamine |
| SMILES | COc1c(F)c(F)c(C(C)=NO)c(S)c1F |
| InChI | InChI=1S/C9H8F3NO2S/c1-3(13-14)4-5(10)6(11)8(15-2)7(12)9(4)16/h14,16H,1-2H3 |
| InChIKey | QZHAOCPLPGBIJC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|