C40H40F12N4O3 — CID 91600959
5,10,15-tris(2,3,5,6-tetrafluoro-4-methoxyphenyl)-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin (PubChem CID 91600959) has the molecular formula C40H40F12N4O3 and a molecular weight of 852.76 g/mol. Its IUPAC name is 5,10,15-tris(2,3,5,6-tetrafluoro-4-methoxyphenyl)-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin.
| Compound Name | 5,10,15-tris(2,3,5,6-tetrafluoro-4-methoxyphenyl)-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin |
|---|---|
| PubChem CID | 91600959 |
| Molecular Formula | C40H40F12N4O3 |
| Molecular Weight | 852.76 g/mol |
| Exact Mass | 852.29 |
| IUPAC Name | 5,10,15-tris(2,3,5,6-tetrafluoro-4-methoxyphenyl)-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin |
| SMILES | COc1c(F)c(F)c(C2C3CCC(N3)C3CCC(N3)C(c3c(F)c(F)c(OC)c(F)c3F)C3CCC(N3)C(c3c(F)c(F)c(OC)c(F)c3F)C3CCC2N3)c(F)c1F |
| InChI | InChI=1S/C40H40F12N4O3/c1-57-38-32(47)26(41)23(27(42)33(38)48)20-14-6-4-12(53-14)13-5-7-15(54-13)21(24-28(43)34(49)39(58-2)35(50)29(24)44)17-9-11-19(56-17)22(18-10-8-16(20)55-18)25-30(45)36(51)40(59-3)37(52)31(25)46/h12-22,53-56H,4-11H2,1-3H3 |
| InChIKey | JDSNYMUZGVGINW-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 75.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.76 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|