C3F3N3 — CID 12533026
3,5,6-trifluoro-1,2,4-triazine (PubChem CID 12533026) has the molecular formula C3F3N3 and a molecular weight of 135.05 g/mol. Its IUPAC name is 3,5,6-trifluoro-1,2,4-triazine.
| Compound Name | 3,5,6-trifluoro-1,2,4-triazine |
|---|---|
| PubChem CID | 12533026 |
| Molecular Formula | C3F3N3 |
| Molecular Weight | 135.05 g/mol |
| Exact Mass | 135.00 |
| IUPAC Name | 3,5,6-trifluoro-1,2,4-triazine |
| SMILES | Fc1nnc(F)c(F)n1 |
| InChI | InChI=1S/C3F3N3/c4-1-2(5)8-9-3(6)7-1 |
| InChIKey | OSYSZYXZSHPLQR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.05 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |