C24F12N6 — CID 166870449
3,6,7,10,13,16,17,20,23,26,27,30-dodecafluoro-5,8,15,18,25,28-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(22),2(11),3,5,7,9,12(21),13,15,17,19,23,25,27,29-pentadecaene (PubChem CID 166870449) has the molecular formula C24F12N6 and a molecular weight of 600.28 g/mol. Its IUPAC name is 3,6,7,10,13,16,17,20,23,26,27,30-dodecafluoro-5,8,15,18,25,28-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(22),2(11),3,5,7,9,12(21),13,15,17,19,23,25,27,29-pentadecaene.
| Compound Name | 3,6,7,10,13,16,17,20,23,26,27,30-dodecafluoro-5,8,15,18,25,28-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(22),2(11),3,5,7,9,12(21),13,15,17,19,23,25,27,29-pentadecaene |
|---|---|
| PubChem CID | 166870449 |
| Molecular Formula | C24F12N6 |
| Molecular Weight | 600.28 g/mol |
| Exact Mass | 600.00 |
| IUPAC Name | 3,6,7,10,13,16,17,20,23,26,27,30-dodecafluoro-5,8,15,18,25,28-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(22),2(11),3,5,7,9,12(21),13,15,17,19,23,25,27,29-pentadecaene |
| SMILES | Fc1nc2c(F)c3c4c(F)c5nc(F)c(F)nc5c(F)c4c4c(F)c5nc(F)c(F)nc5c(F)c4c3c(F)c2nc1F |
| InChI | InChI=1S/C24F12N6/c25-7-1-2(8(26)14-13(7)37-19(31)20(32)38-14)4-6(12(30)18-17(11(4)29)41-23(35)24(36)42-18)5-3(1)9(27)15-16(10(5)28)40-22(34)21(33)39-15 |
| InChIKey | RYDYGXKVWSJGGK-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.28 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|