C16F2N10 — CID 123550157
10,11-difluoro-6,15-diisocyano-3,5,9,12,16,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8(13),9,11,15,17-nonaene-4,17-dicarbonitrile (PubChem CID 123550157) has the molecular formula C16F2N10 and a molecular weight of 370.24 g/mol. Its IUPAC name is 10,11-difluoro-6,15-diisocyano-3,5,9,12,16,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8(13),9,11,15,17-nonaene-4,17-dicarbonitrile.
| Compound Name | 10,11-difluoro-6,15-diisocyano-3,5,9,12,16,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8(13),9,11,15,17-nonaene-4,17-dicarbonitrile |
|---|---|
| PubChem CID | 123550157 |
| Molecular Formula | C16F2N10 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 10,11-difluoro-6,15-diisocyano-3,5,9,12,16,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8(13),9,11,15,17-nonaene-4,17-dicarbonitrile |
| SMILES | [C-]#[N+]c1nc(C#N)nc2c3nc(C#N)nc([N+]#[C-])c3c3nc(F)c(F)nc3c12 |
| InChI | InChI=1S/C16F2N10/c1-21-15-7-9(23-5(3-19)25-15)10-8(16(22-2)26-6(4-20)24-10)12-11(7)27-13(17)14(18)28-12 |
| InChIKey | SEPINVHPZWJIOJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 133.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|