C6H4N6 — CID 140915767
3,6-diamino-5-isocyanopyrazine-2-carbonitrile (PubChem CID 140915767) has the molecular formula C6H4N6 and a molecular weight of 160.14 g/mol. Its IUPAC name is 3,6-diamino-5-isocyanopyrazine-2-carbonitrile.
| Compound Name | 3,6-diamino-5-isocyanopyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 140915767 |
| Molecular Formula | C6H4N6 |
| Molecular Weight | 160.14 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 3,6-diamino-5-isocyanopyrazine-2-carbonitrile |
| SMILES | [C-]#[N+]c1nc(N)c(C#N)nc1N |
| InChI | InChI=1S/C6H4N6/c1-10-6-5(9)11-3(2-7)4(8)12-6/h(H2,8,12)(H2,9,11) |
| InChIKey | CYPUUEVCBOEGCA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|