C9H9N5 — CID 53406964
5-amino-6-propan-2-ylpyrazine-2,3-dicarbonitrile (PubChem CID 53406964) has the molecular formula C9H9N5 and a molecular weight of 187.21 g/mol. Its IUPAC name is 5-amino-6-propan-2-ylpyrazine-2,3-dicarbonitrile.
| Compound Name | 5-amino-6-propan-2-ylpyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 53406964 |
| Molecular Formula | C9H9N5 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 5-amino-6-propan-2-ylpyrazine-2,3-dicarbonitrile |
| SMILES | CC(C)c1nc(C#N)c(C#N)nc1N |
| InChI | InChI=1S/C9H9N5/c1-5(2)8-9(12)14-7(4-11)6(3-10)13-8/h5H,1-2H3,(H2,12,14) |
| InChIKey | XFMZVWPAGQRQMZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |