C10H10N6 — CID 10488806
5-amino-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile (PubChem CID 10488806) has the molecular formula C10H10N6 and a molecular weight of 214.23 g/mol. Its IUPAC name is 5-amino-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile.
| Compound Name | 5-amino-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 10488806 |
| Molecular Formula | C10H10N6 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 5-amino-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile |
| SMILES | N#Cc1nc(N)c(N2CCCC2)nc1C#N |
| InChI | InChI=1S/C10H10N6/c11-5-7-8(6-12)15-10(9(13)14-7)16-3-1-2-4-16/h1-4H2,(H2,13,14) |
| InChIKey | CZCRKADWZIRFGM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |