About 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile
3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile (PubChem CID 58874356) has the molecular formula C13H16F2N2O
and a molecular weight of 254.28 g/mol. Its IUPAC name is 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile |
| PubChem CID | 58874356 |
| Molecular Formula | C13H16F2N2O |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile |
| SMILES | CC(C)c1cc(OC(F)F)c(C#N)nc1C(C)C |
| InChI | InChI=1S/C13H16F2N2O/c1-7(2)9-5-11(18-13(14)15)10(6-16)17-12(9)8(3)4/h5,7-8,13H,1-4H3 |
| InChIKey | FLLBJUUUELTZPW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile?
The IUPAC name of 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile (CID 58874356) is 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile.
What is the SMILES notation for 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile?
The canonical SMILES for 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile is CC(C)c1cc(OC(F)F)c(C#N)nc1C(C)C.
What is the InChIKey of 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile?
The InChIKey is FLLBJUUUELTZPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F2N2O/c1-7(2)9-5-11(18-13(14)15)10(6-16)17-12(9)8(3)4/h5,7-8,13H,1-4H3.
What are the key properties of 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile?
3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile has a molecular weight of 254.28 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethoxy)-5,6-di(propan-2-yl)pyridine-2-carbonitrile is sourced from PubChem (CID 58874356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).