C9H6F2N2O3 — CID 130078133
6-cyano-3-(difluoromethyl)-5-methoxypyridine-2-carboxylic acid (PubChem CID 130078133) has the molecular formula C9H6F2N2O3 and a molecular weight of 228.15 g/mol. Its IUPAC name is 6-cyano-3-(difluoromethyl)-5-methoxypyridine-2-carboxylic acid.
| Compound Name | 6-cyano-3-(difluoromethyl)-5-methoxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 130078133 |
| Molecular Formula | C9H6F2N2O3 |
| Molecular Weight | 228.15 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 6-cyano-3-(difluoromethyl)-5-methoxypyridine-2-carboxylic acid |
| SMILES | COc1cc(C(F)F)c(C(=O)O)nc1C#N |
| InChI | InChI=1S/C9H6F2N2O3/c1-16-6-2-4(8(10)11)7(9(14)15)13-5(6)3-12/h2,8H,1H3,(H,14,15) |
| InChIKey | SWMQPXWBUIPORB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.15 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |