C8H7BrF2N2O2 — CID 118992492
6-bromo-3-(difluoromethyl)-5-methoxypyridine-2-carboxamide (PubChem CID 118992492) has the molecular formula C8H7BrF2N2O2 and a molecular weight of 281.06 g/mol. Its IUPAC name is 6-bromo-3-(difluoromethyl)-5-methoxypyridine-2-carboxamide.
| Compound Name | 6-bromo-3-(difluoromethyl)-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 118992492 |
| Molecular Formula | C8H7BrF2N2O2 |
| Molecular Weight | 281.06 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 6-bromo-3-(difluoromethyl)-5-methoxypyridine-2-carboxamide |
| SMILES | COc1cc(C(F)F)c(C(N)=O)nc1Br |
| InChI | InChI=1S/C8H7BrF2N2O2/c1-15-4-2-3(7(10)11)5(8(12)14)13-6(4)9/h2,7H,1H3,(H2,12,14) |
| InChIKey | SIOBHJFOXKFNQF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.06 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|