C18N12 — CID 153470848
16,17-diisocyano-3,5,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8,10,12,15,17-nonaene-4,6,10,11-tetracarbonitrile (PubChem CID 153470848) has the molecular formula C18N12 and a molecular weight of 384.28 g/mol. Its IUPAC name is 16,17-diisocyano-3,5,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8,10,12,15,17-nonaene-4,6,10,11-tetracarbonitrile.
| Compound Name | 16,17-diisocyano-3,5,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8,10,12,15,17-nonaene-4,6,10,11-tetracarbonitrile |
|---|---|
| PubChem CID | 153470848 |
| Molecular Formula | C18N12 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 16,17-diisocyano-3,5,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8,10,12,15,17-nonaene-4,6,10,11-tetracarbonitrile |
| SMILES | [C-]#[N+]c1nc2c(nc1[N+]#[C-])c1nc(C#N)nc(C#N)c1c1nc(C#N)c(C#N)nc21 |
| InChI | InChI=1S/C18N12/c1-23-17-18(24-2)30-16-14-12(26-7(3-19)8(4-20)27-14)11-9(5-21)25-10(6-22)28-13(11)15(16)29-17 |
| InChIKey | IPNVGYZYWXVRIZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 181.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|