C20H2N10 — CID 171445898
16,17-diisocyano-3,6,9,12-tetrazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,5,10,11-tetracarbonitrile (PubChem CID 171445898) has the molecular formula C20H2N10 and a molecular weight of 382.31 g/mol. Its IUPAC name is 16,17-diisocyano-3,6,9,12-tetrazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,5,10,11-tetracarbonitrile.
| Compound Name | 16,17-diisocyano-3,6,9,12-tetrazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,5,10,11-tetracarbonitrile |
|---|---|
| PubChem CID | 171445898 |
| Molecular Formula | C20H2N10 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 16,17-diisocyano-3,6,9,12-tetrazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,5,10,11-tetracarbonitrile |
| SMILES | [C-]#[N+]c1cc2c(cc1[N+]#[C-])c1nc(C#N)c(C#N)nc1c1nc(C#N)c(C#N)nc21 |
| InChI | InChI=1S/C20H2N10/c1-25-11-3-9-10(4-12(11)26-2)18-20(30-16(8-24)14(6-22)28-18)19-17(9)27-13(5-21)15(7-23)29-19/h3-4H |
| InChIKey | ISIIZLOFYOZSMQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 155.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|