C20H2F6N8 — CID 59650556
10,11-diisocyano-16,17-bis(trifluoromethyl)-3,6,9,12-tetrazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8(13),9,11,14,16-nonaene-4,5-dicarbonitrile (PubChem CID 59650556) has the molecular formula C20H2F6N8 and a molecular weight of 468.28 g/mol. Its IUPAC name is 10,11-diisocyano-16,17-bis(trifluoromethyl)-3,6,9,12-tetrazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8(13),9,11,14,16-nonaene-4,5-dicarbonitrile.
| Compound Name | 10,11-diisocyano-16,17-bis(trifluoromethyl)-3,6,9,12-tetrazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8(13),9,11,14,16-nonaene-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 59650556 |
| Molecular Formula | C20H2F6N8 |
| Molecular Weight | 468.28 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | 10,11-diisocyano-16,17-bis(trifluoromethyl)-3,6,9,12-tetrazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8(13),9,11,14,16-nonaene-4,5-dicarbonitrile |
| SMILES | [C-]#[N+]c1nc2c3cc(C(F)(F)F)c(C(F)(F)F)cc3c3nc(C#N)c(C#N)nc3c2nc1[N+]#[C-] |
| InChI | InChI=1S/C20H2F6N8/c1-29-17-18(30-2)34-16-14(33-17)8-4-10(20(24,25)26)9(19(21,22)23)3-7(8)13-15(16)32-12(6-28)11(5-27)31-13/h3-4H |
| InChIKey | ZYZKGEVDORALNO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 107.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.28 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|