C24H8N6 — CID 140956153
4,5,10-triisocyano-9,12-diazapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene-11-carbonitrile (PubChem CID 140956153) has the molecular formula C24H8N6 and a molecular weight of 380.37 g/mol. Its IUPAC name is 4,5,10-triisocyano-9,12-diazapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene-11-carbonitrile.
| Compound Name | 4,5,10-triisocyano-9,12-diazapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene-11-carbonitrile |
|---|---|
| PubChem CID | 140956153 |
| Molecular Formula | C24H8N6 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 4,5,10-triisocyano-9,12-diazapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene-11-carbonitrile |
| SMILES | [C-]#[N+]c1cc2c(cc1[N+]#[C-])c1nc([N+]#[C-])c(C#N)nc1c1c3ccccc3ccc21 |
| InChI | InChI=1S/C24H8N6/c1-26-18-10-16-15-9-8-13-6-4-5-7-14(13)21(15)23-22(17(16)11-19(18)27-2)30-24(28-3)20(12-25)29-23/h4-11H |
| InChIKey | WFQLYNRSEFAYCJ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 62.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|