C26H12N4 — CID 162773130
24-isocyano-19,26-diazahexacyclo[16.8.0.02,11.03,8.012,17.020,25]hexacosa-1(26),2(11),3,5,7,9,12,14,16,18,20(25),21,23-tridecaene-22-carbonitrile (PubChem CID 162773130) has the molecular formula C26H12N4 and a molecular weight of 380.41 g/mol. Its IUPAC name is 24-isocyano-19,26-diazahexacyclo[16.8.0.02,11.03,8.012,17.020,25]hexacosa-1(26),2(11),3,5,7,9,12,14,16,18,20(25),21,23-tridecaene-22-carbonitrile.
| Compound Name | 24-isocyano-19,26-diazahexacyclo[16.8.0.02,11.03,8.012,17.020,25]hexacosa-1(26),2(11),3,5,7,9,12,14,16,18,20(25),21,23-tridecaene-22-carbonitrile |
|---|---|
| PubChem CID | 162773130 |
| Molecular Formula | C26H12N4 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 24-isocyano-19,26-diazahexacyclo[16.8.0.02,11.03,8.012,17.020,25]hexacosa-1(26),2(11),3,5,7,9,12,14,16,18,20(25),21,23-tridecaene-22-carbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc2nc3c4ccccc4c4ccc5ccccc5c4c3nc12 |
| InChI | InChI=1S/C26H12N4/c1-28-21-12-15(14-27)13-22-25(21)30-26-23-17-7-3-2-6-16(17)10-11-19(23)18-8-4-5-9-20(18)24(26)29-22/h2-13H |
| InChIKey | VWVOZDQMKCYDLX-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|