C36H18N6 — CID 164767765
4-[5-isocyano-3-(4-isocyanophenyl)-7-phenylpyrazino[2,3-k]phenanthridin-2-yl]benzonitrile (PubChem CID 164767765) has the molecular formula C36H18N6 and a molecular weight of 534.58 g/mol. Its IUPAC name is 4-[5-isocyano-3-(4-isocyanophenyl)-7-phenylpyrazino[2,3-k]phenanthridin-2-yl]benzonitrile.
| Compound Name | 4-[5-isocyano-3-(4-isocyanophenyl)-7-phenylpyrazino[2,3-k]phenanthridin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 164767765 |
| Molecular Formula | C36H18N6 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 4-[5-isocyano-3-(4-isocyanophenyl)-7-phenylpyrazino[2,3-k]phenanthridin-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2nc3c([N+]#[C-])cc4c(-c5ccccc5)nc5ccccc5c4c3nc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C36H18N6/c1-38-26-18-16-25(17-19-26)33-34(24-14-12-22(21-37)13-15-24)42-36-31-27-10-6-7-11-29(27)40-32(23-8-4-3-5-9-23)28(31)20-30(39-2)35(36)41-33/h3-20H |
| InChIKey | VIWZQZQTNBSKJH-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 71.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|