C52H31N5 — CID 164767615
7-[3-(4-carbazol-9-ylphenyl)phenyl]-5-isocyano-2,3-diphenylpyrazino[2,3-k]phenanthridine (PubChem CID 164767615) has the molecular formula C52H31N5 and a molecular weight of 725.86 g/mol. Its IUPAC name is 7-[3-(4-carbazol-9-ylphenyl)phenyl]-5-isocyano-2,3-diphenylpyrazino[2,3-k]phenanthridine.
| Compound Name | 7-[3-(4-carbazol-9-ylphenyl)phenyl]-5-isocyano-2,3-diphenylpyrazino[2,3-k]phenanthridine |
|---|---|
| PubChem CID | 164767615 |
| Molecular Formula | C52H31N5 |
| Molecular Weight | 725.86 g/mol |
| Exact Mass | 725.26 |
| IUPAC Name | 7-[3-(4-carbazol-9-ylphenyl)phenyl]-5-isocyano-2,3-diphenylpyrazino[2,3-k]phenanthridine |
| SMILES | [C-]#[N+]c1cc2c(-c3cccc(-c4ccc(-n5c6ccccc6c6ccccc65)cc4)c3)nc3ccccc3c2c2nc(-c3ccccc3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C52H31N5/c1-53-44-32-42-47(52-51(44)55-49(34-15-4-2-5-16-34)50(56-52)35-17-6-3-7-18-35)41-23-8-11-24-43(41)54-48(42)37-20-14-19-36(31-37)33-27-29-38(30-28-33)57-45-25-12-9-21-39(45)40-22-10-13-26-46(40)57/h2-32H |
| InChIKey | IPBHDTYZXQNYGP-UHFFFAOYSA-N |
| XLogP | 13.65 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.86 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|