C52H33N4OP — CID 164767600
7-[2-(4-diphenylphosphorylphenyl)phenyl]-5-isocyano-2,3-diphenylpyrazino[2,3-k]phenanthridine (PubChem CID 164767600) has the molecular formula C52H33N4OP and a molecular weight of 760.84 g/mol. Its IUPAC name is 7-[2-(4-diphenylphosphorylphenyl)phenyl]-5-isocyano-2,3-diphenylpyrazino[2,3-k]phenanthridine.
| Compound Name | 7-[2-(4-diphenylphosphorylphenyl)phenyl]-5-isocyano-2,3-diphenylpyrazino[2,3-k]phenanthridine |
|---|---|
| PubChem CID | 164767600 |
| Molecular Formula | C52H33N4OP |
| Molecular Weight | 760.84 g/mol |
| Exact Mass | 760.24 |
| IUPAC Name | 7-[2-(4-diphenylphosphorylphenyl)phenyl]-5-isocyano-2,3-diphenylpyrazino[2,3-k]phenanthridine |
| SMILES | [C-]#[N+]c1cc2c(-c3ccccc3-c3ccc(P(=O)(c4ccccc4)c4ccccc4)cc3)nc3ccccc3c2c2nc(-c3ccccc3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C52H33N4OP/c1-53-46-34-44-47(52-51(46)55-48(36-18-6-2-7-19-36)49(56-52)37-20-8-3-9-21-37)43-28-16-17-29-45(43)54-50(44)42-27-15-14-26-41(42)35-30-32-40(33-31-35)58(57,38-22-10-4-11-23-38)39-24-12-5-13-25-39/h2-34H |
| InChIKey | POVUEDVDUSHDFK-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 60.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.84 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|