C44H23F3N6 — CID 164998926
4-[5-isocyano-3-(4-isocyanophenyl)-7-[4-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]pyrazino[2,3-k]phenanthridin-2-yl]benzonitrile (PubChem CID 164998926) has the molecular formula C44H23F3N6 and a molecular weight of 692.70 g/mol. Its IUPAC name is 4-[5-isocyano-3-(4-isocyanophenyl)-7-[4-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]pyrazino[2,3-k]phenanthridin-2-yl]benzonitrile.
| Compound Name | 4-[5-isocyano-3-(4-isocyanophenyl)-7-[4-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]pyrazino[2,3-k]phenanthridin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 164998926 |
| Molecular Formula | C44H23F3N6 |
| Molecular Weight | 692.70 g/mol |
| Exact Mass | 692.19 |
| IUPAC Name | 4-[5-isocyano-3-(4-isocyanophenyl)-7-[4-[3-methyl-5-(trifluoromethyl)phenyl]phenyl]pyrazino[2,3-k]phenanthridin-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2nc3c([N+]#[C-])cc4c(-c5ccc(-c6cc(C)cc(C(F)(F)F)c6)cc5)nc5ccccc5c4c3nc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C44H23F3N6/c1-25-20-31(22-32(21-25)44(45,46)47)27-12-14-28(15-13-27)39-35-23-37(50-3)42-43(38(35)34-6-4-5-7-36(34)51-39)53-41(29-10-8-26(24-48)9-11-29)40(52-42)30-16-18-33(49-2)19-17-30/h4-23H,1H3 |
| InChIKey | NUHYBELHJSJQEW-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 71.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.70 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|