C49H25F6N5 — CID 167064009
4-[7-[2-[3,5-bis(trifluoromethyl)phenyl]phenyl]-2-(4-cyanophenyl)-5-phenylpyrazino[2,3-k]phenanthridin-3-yl]benzonitrile (PubChem CID 167064009) has the molecular formula C49H25F6N5 and a molecular weight of 797.76 g/mol. Its IUPAC name is 4-[7-[2-[3,5-bis(trifluoromethyl)phenyl]phenyl]-2-(4-cyanophenyl)-5-phenylpyrazino[2,3-k]phenanthridin-3-yl]benzonitrile.
| Compound Name | 4-[7-[2-[3,5-bis(trifluoromethyl)phenyl]phenyl]-2-(4-cyanophenyl)-5-phenylpyrazino[2,3-k]phenanthridin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 167064009 |
| Molecular Formula | C49H25F6N5 |
| Molecular Weight | 797.76 g/mol |
| Exact Mass | 797.20 |
| IUPAC Name | 4-[7-[2-[3,5-bis(trifluoromethyl)phenyl]phenyl]-2-(4-cyanophenyl)-5-phenylpyrazino[2,3-k]phenanthridin-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc3c(-c4ccccc4)cc4c(-c5ccccc5-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)nc5ccccc5c4c3nc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C49H25F6N5/c50-48(51,52)34-22-33(23-35(24-34)49(53,54)55)36-10-4-5-11-37(36)45-40-25-39(30-8-2-1-3-9-30)46-47(42(40)38-12-6-7-13-41(38)58-45)60-44(32-20-16-29(27-57)17-21-32)43(59-46)31-18-14-28(26-56)15-19-31/h1-25H |
| InChIKey | VSJJUVYHUNNFJV-UHFFFAOYSA-N |
| XLogP | 13.45 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.76 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|