C35H15N7O — CID 165382782
2-[4-[4-(4-cyanophenyl)-[1,2,5]oxadiazolo[3,4-k]phenanthridin-6-yl]phenyl]benzene-1,3,5-tricarbonitrile (PubChem CID 165382782) has the molecular formula C35H15N7O and a molecular weight of 549.55 g/mol. Its IUPAC name is 2-[4-[4-(4-cyanophenyl)-[1,2,5]oxadiazolo[3,4-k]phenanthridin-6-yl]phenyl]benzene-1,3,5-tricarbonitrile.
| Compound Name | 2-[4-[4-(4-cyanophenyl)-[1,2,5]oxadiazolo[3,4-k]phenanthridin-6-yl]phenyl]benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 165382782 |
| Molecular Formula | C35H15N7O |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 2-[4-[4-(4-cyanophenyl)-[1,2,5]oxadiazolo[3,4-k]phenanthridin-6-yl]phenyl]benzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1ccc(-c2cc3c(-c4ccc(-c5c(C#N)cc(C#N)cc5C#N)cc4)nc4ccccc4c3c3nonc23)cc1 |
| InChI | InChI=1S/C35H15N7O/c36-16-20-5-7-22(8-6-20)28-15-29-32(35-34(28)41-43-42-35)27-3-1-2-4-30(27)40-33(29)24-11-9-23(10-12-24)31-25(18-38)13-21(17-37)14-26(31)19-39/h1-15H |
| InChIKey | CKUXFAQBKTWILF-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 146.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|