C40H24N6O — CID 165383408
4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-[1,2,5]oxadiazolo[3,4-k]phenanthridine (PubChem CID 165383408) has the molecular formula C40H24N6O and a molecular weight of 604.67 g/mol. Its IUPAC name is 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-[1,2,5]oxadiazolo[3,4-k]phenanthridine.
| Compound Name | 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-[1,2,5]oxadiazolo[3,4-k]phenanthridine |
|---|---|
| PubChem CID | 165383408 |
| Molecular Formula | C40H24N6O |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | 4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-[1,2,5]oxadiazolo[3,4-k]phenanthridine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4cc5c(-c6ccccc6)nc6ccccc6c5c5nonc45)cc3)n2)cc1 |
| InChI | InChI=1S/C40H24N6O/c1-4-12-26(13-5-1)35-32-24-31(36-37(46-47-45-36)34(32)30-18-10-11-19-33(30)41-35)25-20-22-29(23-21-25)40-43-38(27-14-6-2-7-15-27)42-39(44-40)28-16-8-3-9-17-28/h1-24H |
| InChIKey | QBXLGSHKHUDULN-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|