C35H12F3N7S — CID 163645456
5-[4-[6-(3,5-dicyanophenyl)-[1,2,5]thiadiazolo[3,4-k]phenanthridin-4-yl]phenyl]-2,4,6-trifluorobenzene-1,3-dicarbonitrile (PubChem CID 163645456) has the molecular formula C35H12F3N7S and a molecular weight of 619.59 g/mol. Its IUPAC name is 5-[4-[6-(3,5-dicyanophenyl)-[1,2,5]thiadiazolo[3,4-k]phenanthridin-4-yl]phenyl]-2,4,6-trifluorobenzene-1,3-dicarbonitrile.
| Compound Name | 5-[4-[6-(3,5-dicyanophenyl)-[1,2,5]thiadiazolo[3,4-k]phenanthridin-4-yl]phenyl]-2,4,6-trifluorobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 163645456 |
| Molecular Formula | C35H12F3N7S |
| Molecular Weight | 619.59 g/mol |
| Exact Mass | 619.08 |
| IUPAC Name | 5-[4-[6-(3,5-dicyanophenyl)-[1,2,5]thiadiazolo[3,4-k]phenanthridin-4-yl]phenyl]-2,4,6-trifluorobenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2nc3ccccc3c3c2cc(-c2ccc(-c4c(F)c(C#N)c(F)c(C#N)c4F)cc2)c2nsnc23)c1 |
| InChI | InChI=1S/C35H12F3N7S/c36-30-25(15-41)31(37)28(32(38)26(30)16-42)20-7-5-19(6-8-20)23-12-24-29(35-34(23)44-46-45-35)22-3-1-2-4-27(22)43-33(24)21-10-17(13-39)9-18(11-21)14-40/h1-12H |
| InChIKey | IHVLEPNREACZCB-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 133.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.59 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|