C33H14F3N5O — CID 165382776
2,4,6-trifluoro-5-[4-[4-([1,2,5]oxadiazolo[3,4-k]phenanthridin-6-yl)phenyl]phenyl]benzene-1,3-dicarbonitrile (PubChem CID 165382776) has the molecular formula C33H14F3N5O and a molecular weight of 553.50 g/mol. Its IUPAC name is 2,4,6-trifluoro-5-[4-[4-([1,2,5]oxadiazolo[3,4-k]phenanthridin-6-yl)phenyl]phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 2,4,6-trifluoro-5-[4-[4-([1,2,5]oxadiazolo[3,4-k]phenanthridin-6-yl)phenyl]phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 165382776 |
| Molecular Formula | C33H14F3N5O |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 2,4,6-trifluoro-5-[4-[4-([1,2,5]oxadiazolo[3,4-k]phenanthridin-6-yl)phenyl]phenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(F)c(C#N)c(F)c(-c2ccc(-c3ccc(-c4nc5ccccc5c5c4ccc4nonc45)cc3)cc2)c1F |
| InChI | InChI=1S/C33H14F3N5O/c34-29-23(15-37)30(35)27(31(36)24(29)16-38)19-9-5-17(6-10-19)18-7-11-20(12-8-18)32-22-13-14-26-33(41-42-40-26)28(22)21-3-1-2-4-25(21)39-32/h1-14H |
| InChIKey | FXTWMNDMVXGOLJ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 99.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|