C34H13F3N6S — CID 165382911
5-[4-[9-(2-cyanophenyl)-[1,2,5]thiadiazolo[3,4-k]phenanthridin-6-yl]phenyl]-2,4,6-trifluorobenzene-1,3-dicarbonitrile (PubChem CID 165382911) has the molecular formula C34H13F3N6S and a molecular weight of 594.58 g/mol. Its IUPAC name is 5-[4-[9-(2-cyanophenyl)-[1,2,5]thiadiazolo[3,4-k]phenanthridin-6-yl]phenyl]-2,4,6-trifluorobenzene-1,3-dicarbonitrile.
| Compound Name | 5-[4-[9-(2-cyanophenyl)-[1,2,5]thiadiazolo[3,4-k]phenanthridin-6-yl]phenyl]-2,4,6-trifluorobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 165382911 |
| Molecular Formula | C34H13F3N6S |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 594.09 |
| IUPAC Name | 5-[4-[9-(2-cyanophenyl)-[1,2,5]thiadiazolo[3,4-k]phenanthridin-6-yl]phenyl]-2,4,6-trifluorobenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1ccccc1-c1ccc2c(c1)nc(-c1ccc(-c3c(F)c(C#N)c(F)c(C#N)c3F)cc1)c1ccc3nsnc3c12 |
| InChI | InChI=1S/C34H13F3N6S/c35-30-24(15-39)31(36)28(32(37)25(30)16-40)17-5-7-18(8-6-17)33-23-11-12-26-34(43-44-42-26)29(23)22-10-9-19(13-27(22)41-33)21-4-2-1-3-20(21)14-38/h1-13H |
| InChIKey | XSSGFGLWIUFTOD-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 110.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|