C52H32N6S — CID 165383129
9-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridine (PubChem CID 165383129) has the molecular formula C52H32N6S and a molecular weight of 772.94 g/mol. Its IUPAC name is 9-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridine.
| Compound Name | 9-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridine |
|---|---|
| PubChem CID | 165383129 |
| Molecular Formula | C52H32N6S |
| Molecular Weight | 772.94 g/mol |
| Exact Mass | 772.24 |
| IUPAC Name | 9-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cccc(-c5ccc6c(c5)nc(-c5ccccc5)c5ccc7nsnc7c56)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C52H32N6S/c1-4-11-33(12-5-1)35-19-23-38(24-20-35)50-54-51(39-25-21-36(22-26-39)34-13-6-2-7-14-34)56-52(55-50)42-18-10-17-40(31-42)41-27-28-43-46(32-41)53-48(37-15-8-3-9-16-37)44-29-30-45-49(47(43)44)58-59-57-45/h1-32H |
| InChIKey | WXRXWDPJGWQQFL-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.94 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|