C32H18N4S — CID 165383096
4-[4-(6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridin-9-yl)phenyl]benzonitrile (PubChem CID 165383096) has the molecular formula C32H18N4S and a molecular weight of 490.59 g/mol. Its IUPAC name is 4-[4-(6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridin-9-yl)phenyl]benzonitrile.
| Compound Name | 4-[4-(6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridin-9-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 165383096 |
| Molecular Formula | C32H18N4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 4-[4-(6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridin-9-yl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3ccc4c(c3)nc(-c3ccccc3)c3ccc5nsnc5c34)cc2)cc1 |
| InChI | InChI=1S/C32H18N4S/c33-19-20-6-8-21(9-7-20)22-10-12-23(13-11-22)25-14-15-26-29(18-25)34-31(24-4-2-1-3-5-24)27-16-17-28-32(30(26)27)36-37-35-28/h1-18H |
| InChIKey | XONKRSPLDXQJSW-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|