C33H13F4N5S — CID 165382884
4-[9-(3-cyanophenyl)-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridin-4-yl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 165382884) has the molecular formula C33H13F4N5S and a molecular weight of 587.56 g/mol. Its IUPAC name is 4-[9-(3-cyanophenyl)-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridin-4-yl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[9-(3-cyanophenyl)-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridin-4-yl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 165382884 |
| Molecular Formula | C33H13F4N5S |
| Molecular Weight | 587.56 g/mol |
| Exact Mass | 587.08 |
| IUPAC Name | 4-[9-(3-cyanophenyl)-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridin-4-yl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | N#Cc1cccc(-c2ccc3c(c2)nc(-c2ccccc2)c2cc(-c4c(F)c(F)c(C#N)c(F)c4F)c4nsnc4c23)c1 |
| InChI | InChI=1S/C33H13F4N5S/c34-27-23(15-39)28(35)30(37)26(29(27)36)22-13-21-25(33-32(22)41-43-42-33)20-10-9-19(18-8-4-5-16(11-18)14-38)12-24(20)40-31(21)17-6-2-1-3-7-17/h1-13H |
| InChIKey | YAFCHERIKWURNY-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.56 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|