C38H19F4N5 — CID 165383098
4-[4-(2,6-diphenyltriazolo[4,5-k]phenanthridin-9-yl)phenyl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 165383098) has the molecular formula C38H19F4N5 and a molecular weight of 621.60 g/mol. Its IUPAC name is 4-[4-(2,6-diphenyltriazolo[4,5-k]phenanthridin-9-yl)phenyl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[4-(2,6-diphenyltriazolo[4,5-k]phenanthridin-9-yl)phenyl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 165383098 |
| Molecular Formula | C38H19F4N5 |
| Molecular Weight | 621.60 g/mol |
| Exact Mass | 621.16 |
| IUPAC Name | 4-[4-(2,6-diphenyltriazolo[4,5-k]phenanthridin-9-yl)phenyl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | N#Cc1c(F)c(F)c(-c2ccc(-c3ccc4c(c3)nc(-c3ccccc3)c3ccc5nn(-c6ccccc6)nc5c34)cc2)c(F)c1F |
| InChI | InChI=1S/C38H19F4N5/c39-33-28(20-43)34(40)36(42)31(35(33)41)22-13-11-21(12-14-22)24-15-16-26-30(19-24)44-37(23-7-3-1-4-8-23)27-17-18-29-38(32(26)27)46-47(45-29)25-9-5-2-6-10-25/h1-19H |
| InChIKey | XKUDZVRKQGQELB-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.60 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|