C47H30N6 — CID 165382780
11-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-2,6-diphenyltriazolo[4,5-k]phenanthridine (PubChem CID 165382780) has the molecular formula C47H30N6 and a molecular weight of 678.80 g/mol. Its IUPAC name is 11-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-2,6-diphenyltriazolo[4,5-k]phenanthridine.
| Compound Name | 11-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-2,6-diphenyltriazolo[4,5-k]phenanthridine |
|---|---|
| PubChem CID | 165382780 |
| Molecular Formula | C47H30N6 |
| Molecular Weight | 678.80 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | 11-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-2,6-diphenyltriazolo[4,5-k]phenanthridine |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4cccc5nc(-c6ccccc6)c6ccc7nn(-c8ccccc8)nc7c6c45)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C47H30N6/c1-5-14-32(15-6-1)41-30-42(50-47(49-41)35-18-9-3-10-19-35)33-26-24-31(25-27-33)37-22-13-23-39-43(37)44-38(45(48-39)34-16-7-2-8-17-34)28-29-40-46(44)52-53(51-40)36-20-11-4-12-21-36/h1-30H |
| InChIKey | FMALBDDMCNYWGH-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.80 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|