C33H15F2N5S — CID 165383233
3,5-difluoro-4-[4-(2-isocyanophenyl)-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridin-9-yl]benzonitrile (PubChem CID 165383233) has the molecular formula C33H15F2N5S and a molecular weight of 551.58 g/mol. Its IUPAC name is 3,5-difluoro-4-[4-(2-isocyanophenyl)-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridin-9-yl]benzonitrile.
| Compound Name | 3,5-difluoro-4-[4-(2-isocyanophenyl)-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridin-9-yl]benzonitrile |
|---|---|
| PubChem CID | 165383233 |
| Molecular Formula | C33H15F2N5S |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | 3,5-difluoro-4-[4-(2-isocyanophenyl)-6-phenyl-[1,2,5]thiadiazolo[3,4-k]phenanthridin-9-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccccc1-c1cc2c(-c3ccccc3)nc3cc(-c4c(F)cc(C#N)cc4F)ccc3c2c2nsnc12 |
| InChI | InChI=1S/C33H15F2N5S/c1-37-27-10-6-5-9-21(27)23-16-24-30(33-32(23)39-41-40-33)22-12-11-20(29-25(34)13-18(17-36)14-26(29)35)15-28(22)38-31(24)19-7-3-2-4-8-19/h2-16H |
| InChIKey | BYOXWJIEEKKMKJ-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 66.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|