C43H29N5O — CID 165382813
6-[4-[4-[2,6-bis(4-methylphenyl)pyrimidin-4-yl]phenyl]phenyl]-[1,2,5]oxadiazolo[3,4-k]phenanthridine (PubChem CID 165382813) has the molecular formula C43H29N5O and a molecular weight of 631.74 g/mol. Its IUPAC name is 6-[4-[4-[2,6-bis(4-methylphenyl)pyrimidin-4-yl]phenyl]phenyl]-[1,2,5]oxadiazolo[3,4-k]phenanthridine.
| Compound Name | 6-[4-[4-[2,6-bis(4-methylphenyl)pyrimidin-4-yl]phenyl]phenyl]-[1,2,5]oxadiazolo[3,4-k]phenanthridine |
|---|---|
| PubChem CID | 165382813 |
| Molecular Formula | C43H29N5O |
| Molecular Weight | 631.74 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | 6-[4-[4-[2,6-bis(4-methylphenyl)pyrimidin-4-yl]phenyl]phenyl]-[1,2,5]oxadiazolo[3,4-k]phenanthridine |
| SMILES | Cc1ccc(-c2cc(-c3ccc(-c4ccc(-c5nc6ccccc6c6c5ccc5nonc56)cc4)cc3)nc(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C43H29N5O/c1-26-7-11-30(12-8-26)38-25-39(46-43(45-38)33-13-9-27(2)10-14-33)31-19-15-28(16-20-31)29-17-21-32(22-18-29)41-35-23-24-37-42(48-49-47-37)40(35)34-5-3-4-6-36(34)44-41/h3-25H,1-2H3 |
| InChIKey | KFUOIWQGFYMVBV-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.74 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|