C41H23N5 — CID 164767919
5-[2-(2,3-diphenylpyrazino[2,3-k]phenanthridin-7-yl)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 164767919) has the molecular formula C41H23N5 and a molecular weight of 585.67 g/mol. Its IUPAC name is 5-[2-(2,3-diphenylpyrazino[2,3-k]phenanthridin-7-yl)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[2-(2,3-diphenylpyrazino[2,3-k]phenanthridin-7-yl)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 164767919 |
| Molecular Formula | C41H23N5 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | 5-[2-(2,3-diphenylpyrazino[2,3-k]phenanthridin-7-yl)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2ccccc2-c2nc3ccccc3c3c2ccc2nc(-c4ccccc4)c(-c4ccccc4)nc23)c1 |
| InChI | InChI=1S/C41H23N5/c42-24-26-21-27(25-43)23-30(22-26)31-15-7-8-16-32(31)40-34-19-20-36-41(37(34)33-17-9-10-18-35(33)44-40)46-39(29-13-5-2-6-14-29)38(45-36)28-11-3-1-4-12-28/h1-23H |
| InChIKey | SVXRIBTYTPYORH-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|