C49H25N7 — CID 164767934
5-[5-[4-(3-cyano-5-isocyanophenyl)phenyl]-2,3-diphenylpyrazino[2,3-i]phenanthridin-11-yl]benzene-1,3-dicarbonitrile (PubChem CID 164767934) has the molecular formula C49H25N7 and a molecular weight of 711.79 g/mol. Its IUPAC name is 5-[5-[4-(3-cyano-5-isocyanophenyl)phenyl]-2,3-diphenylpyrazino[2,3-i]phenanthridin-11-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[5-[4-(3-cyano-5-isocyanophenyl)phenyl]-2,3-diphenylpyrazino[2,3-i]phenanthridin-11-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 164767934 |
| Molecular Formula | C49H25N7 |
| Molecular Weight | 711.79 g/mol |
| Exact Mass | 711.22 |
| IUPAC Name | 5-[5-[4-(3-cyano-5-isocyanophenyl)phenyl]-2,3-diphenylpyrazino[2,3-i]phenanthridin-11-yl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2ccc(-c3nc4ccccc4c4c(-c5cc(C#N)cc(C#N)c5)cc5nc(-c6ccccc6)c(-c6ccccc6)nc5c34)cc2)c1 |
| InChI | InChI=1S/C49H25N7/c1-53-39-24-32(29-52)21-37(25-39)33-16-18-36(19-17-33)46-45-44(40-14-8-9-15-42(40)54-46)41(38-22-30(27-50)20-31(23-38)28-51)26-43-49(45)56-48(35-12-6-3-7-13-35)47(55-43)34-10-4-2-5-11-34/h2-26H |
| InChIKey | GSUKRAKQMFCACW-UHFFFAOYSA-N |
| XLogP | 11.83 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.79 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|